About (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one
(1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one (PubChem CID 59093997) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one.
Molecular Properties
| Compound Name | (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one |
| PubChem CID | 59093997 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one |
| SMILES | O=C1CC2(CN1)C[C@H]1CC[C@H]1C2 |
| InChI | InChI=1S/C10H15NO/c12-9-5-10(6-11-9)3-7-1-2-8(7)4-10/h7-8H,1-6H2,(H,11,12)/t7-,8+,10? |
| InChIKey | HRIKIYHMOUEACV-JWHQNHQBSA-N |
| XLogP | 1.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one?
The IUPAC name of (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one (CID 59093997) is (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one.
What is the SMILES notation for (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one?
The canonical SMILES for (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one is O=C1CC2(CN1)C[C@H]1CC[C@H]1C2.
What is the InChIKey of (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one?
The InChIKey is HRIKIYHMOUEACV-JWHQNHQBSA-N. The full InChI is InChI=1S/C10H15NO/c12-9-5-10(6-11-9)3-7-1-2-8(7)4-10/h7-8H,1-6H2,(H,11,12)/t7-,8+,10?.
What are the key properties of (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one?
(1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one has a molecular weight of 165.24 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-spiro[bicyclo[3.2.0]heptane-3,4'-pyrrolidine]-2'-one is sourced from PubChem (CID 59093997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).