About 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one
4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one (PubChem CID 59094098) has the molecular formula C26H18Cl2O4
and a molecular weight of 465.33 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one.
Molecular Properties
| Compound Name | 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one |
| PubChem CID | 59094098 |
| Molecular Formula | C26H18Cl2O4 |
| Molecular Weight | 465.33 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one |
| SMILES | C=C(C)COc1ccc2c(=O)c3ccccc3oc2c1C(=O)C=Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H18Cl2O4/c1-15(2)14-31-23-13-11-18-25(30)17-6-3-4-9-22(17)32-26(18)24(23)21(29)12-10-16-19(27)7-5-8-20(16)28/h3-13H,1,14H2,2H3 |
| InChIKey | AATCLOJGIJUTNM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.33 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one?
The IUPAC name of 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one (CID 59094098) is 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one.
What is the SMILES notation for 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one?
The canonical SMILES for 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one is C=C(C)COc1ccc2c(=O)c3ccccc3oc2c1C(=O)C=Cc1c(Cl)cccc1Cl.
What is the InChIKey of 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one?
The InChIKey is AATCLOJGIJUTNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18Cl2O4/c1-15(2)14-31-23-13-11-18-25(30)17-6-3-4-9-22(17)32-26(18)24(23)21(29)12-10-16-19(27)7-5-8-20(16)28/h3-13H,1,14H2,2H3.
What are the key properties of 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one?
4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one has a molecular weight of 465.33 g/mol, XLogP of 7.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,6-dichlorophenyl)prop-2-enoyl]-3-(2-methylprop-2-enoxy)xanthen-9-one is sourced from PubChem (CID 59094098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).