C16H24O2 — CID 59094324
(3R,4R,5S)-5-hydroxy-3,4,10,11,11-pentamethyltricyclo[5.3.1.01,5]undec-9-en-2-one (PubChem CID 59094324) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3R,4R,5S)-5-hydroxy-3,4,10,11,11-pentamethyltricyclo[5.3.1.01,5]undec-9-en-2-one.
| Compound Name | (3R,4R,5S)-5-hydroxy-3,4,10,11,11-pentamethyltricyclo[5.3.1.01,5]undec-9-en-2-one |
|---|---|
| PubChem CID | 59094324 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3R,4R,5S)-5-hydroxy-3,4,10,11,11-pentamethyltricyclo[5.3.1.01,5]undec-9-en-2-one |
| SMILES | CC1=CCC2C[C@]3(O)[C@H](C)[C@@H](C)C(=O)C13C2(C)C |
| InChI | InChI=1S/C16H24O2/c1-9-6-7-12-8-15(18)11(3)10(2)13(17)16(9,15)14(12,4)5/h6,10-12,18H,7-8H2,1-5H3/t10-,11-,12?,15+,16?/m1/s1 |
| InChIKey | FEHGTAAFFYYRJY-DRQFSCOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|