C15H9NO — CID 59094477
N-tridec-1-en-3,5,7,9,11-pentaynylacetamide (PubChem CID 59094477) has the molecular formula C15H9NO and a molecular weight of 219.24 g/mol. Its IUPAC name is N-tridec-1-en-3,5,7,9,11-pentaynylacetamide.
| Compound Name | N-tridec-1-en-3,5,7,9,11-pentaynylacetamide |
|---|---|
| PubChem CID | 59094477 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-tridec-1-en-3,5,7,9,11-pentaynylacetamide |
| SMILES | CC#CC#CC#CC#CC#CC=CNC(C)=O |
| InChI | InChI=1S/C15H9NO/c1-3-4-5-6-7-8-9-10-11-12-13-14-16-15(2)17/h13-14H,1-2H3,(H,16,17) |
| InChIKey | IPEIIOBVHVKBJZ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|