C10H15N3O4 — CID 59094495
5-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1H-1,2,4-triazole (PubChem CID 59094495) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1H-1,2,4-triazole.
| Compound Name | 5-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 59094495 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 5-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-1H-1,2,4-triazole |
| SMILES | CO[C@@H]1O[C@H](c2ncn[nH]2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C10H15N3O4/c1-10(2)16-5-6(8-11-4-12-13-8)15-9(14-3)7(5)17-10/h4-7,9H,1-3H3,(H,11,12,13)/t5-,6+,7-,9-/m1/s1 |
| InChIKey | RHUMXGSEDIQMGU-JVZYCSMKSA-N |
| XLogP | 0.37 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |