C17H21N3O4S — CID 59094532
3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-benzyl-1H-1,2,4-triazole-5-thione (PubChem CID 59094532) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-benzyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-benzyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 59094532 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 3-[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-benzyl-1H-1,2,4-triazole-5-thione |
| SMILES | CO[C@@H]1O[C@H](c2n[nH]c(=S)n2Cc2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C17H21N3O4S/c1-17(2)23-11-12(22-15(21-3)13(11)24-17)14-18-19-16(25)20(14)9-10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3,(H,19,25)/t11-,12+,13-,15-/m1/s1 |
| InChIKey | NPIDSHPHBWTTRA-QVHKTLOISA-N |
| XLogP | 2.55 |
| TPSA | 70.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|