About (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium
(1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium (PubChem CID 59094555) has the molecular formula C10H12NOY-
and a molecular weight of 251.12 g/mol. Its IUPAC name is (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium.
Molecular Properties
| Compound Name | (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium |
| PubChem CID | 59094555 |
| Molecular Formula | C10H12NOY- |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium |
| SMILES | CN1c2cc[c-]cc2CC1CO.[Y] |
| InChI | InChI=1S/C10H12NO.Y/c1-11-9(7-12)6-8-4-2-3-5-10(8)11;/h3-5,9,12H,6-7H2,1H3;/q-1; |
| InChIKey | DFSBXAMLRKHACW-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium?
The IUPAC name of (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium (CID 59094555) is (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium.
What is the SMILES notation for (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium?
The canonical SMILES for (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium is CN1c2cc[c-]cc2CC1CO.[Y].
What is the InChIKey of (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium?
The InChIKey is DFSBXAMLRKHACW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12NO.Y/c1-11-9(7-12)6-8-4-2-3-5-10(8)11;/h3-5,9,12H,6-7H2,1H3;/q-1;.
What are the key properties of (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium?
(1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium has a molecular weight of 251.12 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methyl-3,5-dihydro-2H-indol-5-id-2-yl)methanol;yttrium is sourced from PubChem (CID 59094555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).