About 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium
6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium (PubChem CID 59094603) has the molecular formula C10H7INOY-
and a molecular weight of 372.98 g/mol. Its IUPAC name is 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium.
Molecular Properties
| Compound Name | 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium |
| PubChem CID | 59094603 |
| Molecular Formula | C10H7INOY- |
| Molecular Weight | 372.98 g/mol |
| Exact Mass | 372.86 |
| IUPAC Name | 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium |
| SMILES | Cc1c[nH]c2[c-]cc(I)cc2c1=O.[Y] |
| InChI | InChI=1S/C10H7INO.Y/c1-6-5-12-9-3-2-7(11)4-8(9)10(6)13;/h2,4-5H,1H3,(H,12,13);/q-1; |
| InChIKey | VGQAGVHJWFLBGO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.98 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium?
The IUPAC name of 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium (CID 59094603) is 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium.
What is the SMILES notation for 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium?
The canonical SMILES for 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium is Cc1c[nH]c2[c-]cc(I)cc2c1=O.[Y].
What is the InChIKey of 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium?
The InChIKey is VGQAGVHJWFLBGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7INO.Y/c1-6-5-12-9-3-2-7(11)4-8(9)10(6)13;/h2,4-5H,1H3,(H,12,13);/q-1;.
What are the key properties of 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium?
6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium has a molecular weight of 372.98 g/mol, XLogP of 2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-3-methyl-1,8-dihydroquinolin-8-id-4-one;yttrium is sourced from PubChem (CID 59094603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).