About 5,5-dimethyl-6-tritiohexane-2,4-dione
5,5-dimethyl-6-tritiohexane-2,4-dione (PubChem CID 59094694) has the molecular formula C8H14O2
and a molecular weight of 144.21 g/mol. Its IUPAC name is 5,5-dimethyl-6-tritiohexane-2,4-dione.
Molecular Properties
| Compound Name | 5,5-dimethyl-6-tritiohexane-2,4-dione |
| PubChem CID | 59094694 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 5,5-dimethyl-6-tritiohexane-2,4-dione |
| SMILES | [3H]CC(C)(C)C(=O)CC(C)=O |
| InChI | InChI=1S/C8H14O2/c1-6(9)5-7(10)8(2,3)4/h5H2,1-4H3/i2T |
| InChIKey | LCLCVVVHIPPHCG-FUPOQFPWSA-N |
| XLogP | 1.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-6-tritiohexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-6-tritiohexane-2,4-dione?
The IUPAC name of 5,5-dimethyl-6-tritiohexane-2,4-dione (CID 59094694) is 5,5-dimethyl-6-tritiohexane-2,4-dione.
What is the SMILES notation for 5,5-dimethyl-6-tritiohexane-2,4-dione?
The canonical SMILES for 5,5-dimethyl-6-tritiohexane-2,4-dione is [3H]CC(C)(C)C(=O)CC(C)=O.
What is the InChIKey of 5,5-dimethyl-6-tritiohexane-2,4-dione?
The InChIKey is LCLCVVVHIPPHCG-FUPOQFPWSA-N. The full InChI is InChI=1S/C8H14O2/c1-6(9)5-7(10)8(2,3)4/h5H2,1-4H3/i2T.
What are the key properties of 5,5-dimethyl-6-tritiohexane-2,4-dione?
5,5-dimethyl-6-tritiohexane-2,4-dione has a molecular weight of 144.21 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-6-tritiohexane-2,4-dione is sourced from PubChem (CID 59094694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).