C25H42O9Si — CID 59094724
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate (PubChem CID 59094724) has the molecular formula C25H42O9Si and a molecular weight of 514.69 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 59094724 |
| Molecular Formula | C25H42O9Si |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-6-[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl]-2-hydroxy-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-4-ylidene]acetate |
| SMILES | COC(=O)/C=C1\C[C@@H](C[C@@H](O)CO[Si](C)(C)C(C)(C)C)O[C@@](O)(C(C)(C)/C=C/C=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H42O9Si/c1-17(27)33-22-18(14-21(29)31-7)13-20(34-25(22,30)24(5,6)11-10-12-26)15-19(28)16-32-35(8,9)23(2,3)4/h10-12,14,19-20,22,28,30H,13,15-16H2,1-9H3/b11-10+,18-14+/t19-,20+,22+,25-/m1/s1 |
| InChIKey | ZQIPZLOAEYFJLM-WAHLSRLJSA-N |
| XLogP | 3.05 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|