About sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate
sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 59094739) has the molecular formula C17H15NaO3
and a molecular weight of 290.29 g/mol. Its IUPAC name is sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate |
| PubChem CID | 59094739 |
| Molecular Formula | C17H15NaO3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | Cc1cc(C)cc(/C=C(\C(=O)[O-])c2ccc(O)cc2)c1.[Na+] |
| InChI | InChI=1S/C17H16O3.Na/c1-11-7-12(2)9-13(8-11)10-16(17(19)20)14-3-5-15(18)6-4-14;/h3-10,18H,1-2H3,(H,19,20);/q;+1/p-1/b16-10-; |
| InChIKey | PJTRZXZYNWJIBT-HYMQDMCPSA-M |
| XLogP | -0.70 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate?
The IUPAC name of sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate (CID 59094739) is sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate.
What is the SMILES notation for sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate?
The canonical SMILES for sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate is Cc1cc(C)cc(/C=C(\C(=O)[O-])c2ccc(O)cc2)c1.[Na+].
What is the InChIKey of sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate?
The InChIKey is PJTRZXZYNWJIBT-HYMQDMCPSA-M. The full InChI is InChI=1S/C17H16O3.Na/c1-11-7-12(2)9-13(8-11)10-16(17(19)20)14-3-5-15(18)6-4-14;/h3-10,18H,1-2H3,(H,19,20);/q;+1/p-1/b16-10-;.
What are the key properties of sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate?
sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate has a molecular weight of 290.29 g/mol, XLogP of -0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (Z)-3-(3,5-dimethylphenyl)-2-(4-hydroxyphenyl)prop-2-enoate is sourced from PubChem (CID 59094739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).