C28H37NO6Si — CID 59094974
(4R)-4-benzyl-3-[(2R,3S)-5-(tert-butyl-methoxy-phenylsilyl)oxy-2-ethenyl-3-hydroxypentanoyl]-1,3-oxazolidin-2-one (PubChem CID 59094974) has the molecular formula C28H37NO6Si and a molecular weight of 511.69 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S)-5-(tert-butyl-methoxy-phenylsilyl)oxy-2-ethenyl-3-hydroxypentanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S)-5-(tert-butyl-methoxy-phenylsilyl)oxy-2-ethenyl-3-hydroxypentanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59094974 |
| Molecular Formula | C28H37NO6Si |
| Molecular Weight | 511.69 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S)-5-(tert-butyl-methoxy-phenylsilyl)oxy-2-ethenyl-3-hydroxypentanoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)CCO[Si](OC)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO6Si/c1-6-24(26(31)29-22(20-34-27(29)32)19-21-13-9-7-10-14-21)25(30)17-18-35-36(33-5,28(2,3)4)23-15-11-8-12-16-23/h6-16,22,24-25,30H,1,17-20H2,2-5H3/t22-,24-,25+,36?/m1/s1 |
| InChIKey | IMQVWKPSIUAVEJ-UGTLILJDSA-N |
| XLogP | 3.94 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|