C40H45NO5Si — CID 59095010
(4R)-4-benzyl-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 59095010) has the molecular formula C40H45NO5Si and a molecular weight of 647.89 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59095010 |
| Molecular Formula | C40H45NO5Si |
| Molecular Weight | 647.89 g/mol |
| Exact Mass | 647.31 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z,2R,3S)-2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-3-hydroxy-5-phenylpent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)/C=C\c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H45NO5Si/c1-40(2,3)47(34-21-12-6-13-22-34,35-23-14-7-15-24-35)46-28-16-25-36(37(42)27-26-31-17-8-4-9-18-31)38(43)41-33(30-45-39(41)44)29-32-19-10-5-11-20-32/h4-15,17-24,26-27,33,36-37,42H,16,25,28-30H2,1-3H3/b27-26-/t33-,36-,37+/m1/s1 |
| InChIKey | ICBWOGYCQPDNEM-YWAQXTHLSA-N |
| XLogP | 6.62 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.89 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|