About CID 59095153
CID 59095153 (PubChem CID 59095153) has the molecular formula C11H16N3O
and a molecular weight of 206.27 g/mol.
Molecular Properties
| Compound Name | CID 59095153 |
| PubChem CID | 59095153 |
| Molecular Formula | C11H16N3O |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | — |
| SMILES | COc1nc(N2CCCCC2)ccc1[NH] |
| InChI | InChI=1S/C11H16N3O/c1-15-11-9(12)5-6-10(13-11)14-7-3-2-4-8-14/h5-6,12H,2-4,7-8H2,1H3 |
| InChIKey | AEVCRCHGNAKHDH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 59095153 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59095153?
The IUPAC name of CID 59095153 (CID 59095153) is not available.
What is the SMILES notation for CID 59095153?
The canonical SMILES for CID 59095153 is COc1nc(N2CCCCC2)ccc1[NH].
What is the InChIKey of CID 59095153?
The InChIKey is AEVCRCHGNAKHDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N3O/c1-15-11-9(12)5-6-10(13-11)14-7-3-2-4-8-14/h5-6,12H,2-4,7-8H2,1H3.
What are the key properties of CID 59095153?
CID 59095153 has a molecular weight of 206.27 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59095153 is sourced from PubChem (CID 59095153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).