About 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol
2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol (PubChem CID 59095314) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol.
Molecular Properties
| Compound Name | 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| PubChem CID | 59095314 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1cc(C(C)(C)O)c(C(C)(C)O)cc1C(C)(C)O |
| InChI | InChI=1S/C18H30O4/c1-15(2,19)11-9-13(17(5,6)21)14(18(7,8)22)10-12(11)16(3,4)20/h9-10,19-22H,1-8H3 |
| InChIKey | JNNNURODXTUYFI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The IUPAC name of 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol (CID 59095314) is 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol.
What is the SMILES notation for 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The canonical SMILES for 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol is CC(C)(O)c1cc(C(C)(C)O)c(C(C)(C)O)cc1C(C)(C)O.
What is the InChIKey of 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
The InChIKey is JNNNURODXTUYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-15(2,19)11-9-13(17(5,6)21)14(18(7,8)22)10-12(11)16(3,4)20/h9-10,19-22H,1-8H3.
What are the key properties of 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol?
2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol has a molecular weight of 310.43 g/mol, XLogP of 2.60, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4,5-tris(2-hydroxypropan-2-yl)phenyl]propan-2-ol is sourced from PubChem (CID 59095314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).