C25H27NO4 — CID 59095448
(2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2,2-dimethylbutanoate (PubChem CID 59095448) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2,2-dimethylbutanoate.
| Compound Name | (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59095448 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (2-benzyl-1,3-dioxo-3a,4,9,9a-tetrahydrobenzo[f]isoindol-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1c2ccccc2CC2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C25H27NO4/c1-4-25(2,3)24(29)30-21-18-13-9-8-12-17(18)14-19-20(21)23(28)26(22(19)27)15-16-10-6-5-7-11-16/h5-13,19-21H,4,14-15H2,1-3H3 |
| InChIKey | XWTZUKTUORIWRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|