C9H13N5O — CID 59096222
N,2-dimethyl-6-propan-2-yloxypyrazolo[1,5-b][1,2,4]triazol-7-imine (PubChem CID 59096222) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is N,2-dimethyl-6-propan-2-yloxypyrazolo[1,5-b][1,2,4]triazol-7-imine.
| Compound Name | N,2-dimethyl-6-propan-2-yloxypyrazolo[1,5-b][1,2,4]triazol-7-imine |
|---|---|
| PubChem CID | 59096222 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N,2-dimethyl-6-propan-2-yloxypyrazolo[1,5-b][1,2,4]triazol-7-imine |
| SMILES | C/N=C1\C(OC(C)C)=Nn2nc(C)nc21 |
| InChI | InChI=1S/C9H13N5O/c1-5(2)15-9-7(10-4)8-11-6(3)12-14(8)13-9/h5H,1-4H3/b10-7- |
| InChIKey | VTPQPTMDIBKSKA-YFHOEESVSA-N |
| XLogP | 0.61 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|