C15H24O3 — CID 59096450
2-cyclohexyl-5-hydroxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one (PubChem CID 59096450) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 2-cyclohexyl-5-hydroxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one.
| Compound Name | 2-cyclohexyl-5-hydroxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
|---|---|
| PubChem CID | 59096450 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 2-cyclohexyl-5-hydroxy-2,3,4a,5,6,7,8,8a-octahydrochromen-4-one |
| SMILES | O=C1CC(C2CCCCC2)OC2CCCC(O)C12 |
| InChI | InChI=1S/C15H24O3/c16-11-7-4-8-13-15(11)12(17)9-14(18-13)10-5-2-1-3-6-10/h10-11,13-16H,1-9H2 |
| InChIKey | REAHRJQXSAFJEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |