About 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium
3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium (PubChem CID 59096490) has the molecular formula C9H9N2Sc-
and a molecular weight of 190.14 g/mol. Its IUPAC name is 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium.
Molecular Properties
| Compound Name | 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium |
| PubChem CID | 59096490 |
| Molecular Formula | C9H9N2Sc- |
| Molecular Weight | 190.14 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium |
| SMILES | C1=CC(=CC2=CC=NC2)C[N-]1.[Sc] |
| InChI | InChI=1S/C9H9N2.Sc/c1-3-10-6-8(1)5-9-2-4-11-7-9;/h1-5H,6-7H2;/q-1; |
| InChIKey | LIDPGDFPRJRVDR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.14 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium?
The IUPAC name of 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium (CID 59096490) is 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium.
What is the SMILES notation for 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium?
The canonical SMILES for 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium is C1=CC(=CC2=CC=NC2)C[N-]1.[Sc].
What is the InChIKey of 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium?
The InChIKey is LIDPGDFPRJRVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N2.Sc/c1-3-10-6-8(1)5-9-2-4-11-7-9;/h1-5H,6-7H2;/q-1;.
What are the key properties of 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium?
3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium has a molecular weight of 190.14 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2H-pyrrol-1-id-3-ylidenemethyl)-2H-pyrrole;scandium is sourced from PubChem (CID 59096490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).