C9H9N2Se+ — CID 59096505
2-selena-3-aza-1-azoniatricyclo[6.2.1.13,6]dodeca-1(10),4,6,8-tetraene (PubChem CID 59096505) has the molecular formula C9H9N2Se+ and a molecular weight of 224.15 g/mol. Its IUPAC name is 2-selena-3-aza-1-azoniatricyclo[6.2.1.13,6]dodeca-1(10),4,6,8-tetraene.
| Compound Name | 2-selena-3-aza-1-azoniatricyclo[6.2.1.13,6]dodeca-1(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 59096505 |
| Molecular Formula | C9H9N2Se+ |
| Molecular Weight | 224.15 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2-selena-3-aza-1-azoniatricyclo[6.2.1.13,6]dodeca-1(10),4,6,8-tetraene |
| SMILES | C1=CN2CC1=CC1=CC=[N+](C1)[Se]2 |
| InChI | InChI=1S/C9H9N2Se/c1-3-10-6-8(1)5-9-2-4-11(7-9)12-10/h1-5H,6-7H2/q+1 |
| InChIKey | JRAPJCDLRADIJC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.15 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|