About 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole
5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole (PubChem CID 59096628) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole.
Analyze 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole?
The IUPAC name of 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole (CID 59096628) is 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole.
What is the SMILES notation for 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole?
The canonical SMILES for 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole is CC(C)C1Cc2nc[nH]c2C1.
What is the InChIKey of 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole?
The InChIKey is XDHNNCKHJNWELM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-6(2)7-3-8-9(4-7)11-5-10-8/h5-7H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole?
5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole has a molecular weight of 150.22 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,4,5,6-tetrahydrocyclopenta[d]imidazole is sourced from PubChem (CID 59096628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).