About 6H-naphthalen-6-id-2-ol;tungsten;yttrium
6H-naphthalen-6-id-2-ol;tungsten;yttrium (PubChem CID 59096647) has the molecular formula C10H7OWY-
and a molecular weight of 415.91 g/mol. Its IUPAC name is 6H-naphthalen-6-id-2-ol;tungsten;yttrium.
Molecular Properties
| Compound Name | 6H-naphthalen-6-id-2-ol;tungsten;yttrium |
| PubChem CID | 59096647 |
| Molecular Formula | C10H7OWY- |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.91 |
| IUPAC Name | 6H-naphthalen-6-id-2-ol;tungsten;yttrium |
| SMILES | Oc1ccc2c[c-]ccc2c1.[W].[Y] |
| InChI | InChI=1S/C10H7O.W.Y/c11-10-6-5-8-3-1-2-4-9(8)7-10;;/h2-7,11H;;/q-1;; |
| InChIKey | QUVOPMCWMGOAGO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6H-naphthalen-6-id-2-ol;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-naphthalen-6-id-2-ol;tungsten;yttrium?
The IUPAC name of 6H-naphthalen-6-id-2-ol;tungsten;yttrium (CID 59096647) is 6H-naphthalen-6-id-2-ol;tungsten;yttrium.
What is the SMILES notation for 6H-naphthalen-6-id-2-ol;tungsten;yttrium?
The canonical SMILES for 6H-naphthalen-6-id-2-ol;tungsten;yttrium is Oc1ccc2c[c-]ccc2c1.[W].[Y].
What is the InChIKey of 6H-naphthalen-6-id-2-ol;tungsten;yttrium?
The InChIKey is QUVOPMCWMGOAGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7O.W.Y/c11-10-6-5-8-3-1-2-4-9(8)7-10;;/h2-7,11H;;/q-1;;.
What are the key properties of 6H-naphthalen-6-id-2-ol;tungsten;yttrium?
6H-naphthalen-6-id-2-ol;tungsten;yttrium has a molecular weight of 415.91 g/mol, XLogP of 2.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-naphthalen-6-id-2-ol;tungsten;yttrium is sourced from PubChem (CID 59096647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).