About 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole
2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole (PubChem CID 59096667) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole |
| PubChem CID | 59096667 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole |
| SMILES | Cn1c(C(C)(C)C)nc2c1CCC=C2 |
| InChI | InChI=1S/C12H18N2/c1-12(2,3)11-13-9-7-5-6-8-10(9)14(11)4/h5,7H,6,8H2,1-4H3 |
| InChIKey | WPMHHOLFHRYZDO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole?
The IUPAC name of 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole (CID 59096667) is 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole.
What is the SMILES notation for 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole?
The canonical SMILES for 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole is Cn1c(C(C)(C)C)nc2c1CCC=C2.
What is the InChIKey of 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole?
The InChIKey is WPMHHOLFHRYZDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-12(2,3)11-13-9-7-5-6-8-10(9)14(11)4/h5,7H,6,8H2,1-4H3.
What are the key properties of 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole?
2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole has a molecular weight of 190.29 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-3-methyl-4,5-dihydrobenzimidazole is sourced from PubChem (CID 59096667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).