C27H30N2O2 — CID 59096935
(2S)-3-[4-[(E)-3-(4-phenylpiperidin-1-yl)prop-1-enyl]phenyl]-2-pyrrol-1-ylpropanoic acid (PubChem CID 59096935) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2S)-3-[4-[(E)-3-(4-phenylpiperidin-1-yl)prop-1-enyl]phenyl]-2-pyrrol-1-ylpropanoic acid.
| Compound Name | (2S)-3-[4-[(E)-3-(4-phenylpiperidin-1-yl)prop-1-enyl]phenyl]-2-pyrrol-1-ylpropanoic acid |
|---|---|
| PubChem CID | 59096935 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2S)-3-[4-[(E)-3-(4-phenylpiperidin-1-yl)prop-1-enyl]phenyl]-2-pyrrol-1-ylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(/C=C/CN2CCC(c3ccccc3)CC2)cc1)n1cccc1 |
| InChI | InChI=1S/C27H30N2O2/c30-27(31)26(29-17-4-5-18-29)21-23-12-10-22(11-13-23)7-6-16-28-19-14-25(15-20-28)24-8-2-1-3-9-24/h1-13,17-18,25-26H,14-16,19-21H2,(H,30,31)/b7-6+/t26-/m0/s1 |
| InChIKey | ZCISPDBKGIMJOY-HWMYGDGXSA-N |
| XLogP | 5.25 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |