About CID 59097310
CID 59097310 (PubChem CID 59097310) has the molecular formula C10H17BNO3S
and a molecular weight of 244.14 g/mol.
Molecular Properties
| Compound Name | CID 59097310 |
| PubChem CID | 59097310 |
| Molecular Formula | C10H17BNO3S |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | — |
| SMILES | [3H][B]SO[C@H]1[C@@H]2COC(C)(C)N2C(=O)C1(C)C |
| InChI | InChI=1S/C10H17BNO3S/c1-9(2)7(15-16-11)6-5-14-10(3,4)12(6)8(9)13/h6-7,11H,5H2,1-4H3/t6-,7-/m0/s1/i11T |
| InChIKey | XVQAIMOSQRWKHJ-LLUNKQOASA-N |
| XLogP | 0.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 59097310 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59097310?
The IUPAC name of CID 59097310 (CID 59097310) is not available.
What is the SMILES notation for CID 59097310?
The canonical SMILES for CID 59097310 is [3H][B]SO[C@H]1[C@@H]2COC(C)(C)N2C(=O)C1(C)C.
What is the InChIKey of CID 59097310?
The InChIKey is XVQAIMOSQRWKHJ-LLUNKQOASA-N. The full InChI is InChI=1S/C10H17BNO3S/c1-9(2)7(15-16-11)6-5-14-10(3,4)12(6)8(9)13/h6-7,11H,5H2,1-4H3/t6-,7-/m0/s1/i11T.
What are the key properties of CID 59097310?
CID 59097310 has a molecular weight of 244.14 g/mol, XLogP of 0.84, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59097310 is sourced from PubChem (CID 59097310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).