C11H19NO2 — CID 59097329
(7R)-3,3,6,6,7-pentamethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 59097329) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (7R)-3,3,6,6,7-pentamethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (7R)-3,3,6,6,7-pentamethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 59097329 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (7R)-3,3,6,6,7-pentamethyl-7,7a-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C[C@H]1C2COC(C)(C)N2C(=O)C1(C)C |
| InChI | InChI=1S/C11H19NO2/c1-7-8-6-14-11(4,5)12(8)9(13)10(7,2)3/h7-8H,6H2,1-5H3/t7-,8?/m0/s1 |
| InChIKey | RSDKSPYMGXFVIH-JAMMHHFISA-N |
| XLogP | 1.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |