C14H19F5O5 — CID 59097402
1-O-(oxiran-2-ylmethyl) 5-O-(1,1,2,2,2-pentafluoroethyl) 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 59097402) has the molecular formula C14H19F5O5 and a molecular weight of 362.29 g/mol. Its IUPAC name is 1-O-(oxiran-2-ylmethyl) 5-O-(1,1,2,2,2-pentafluoroethyl) 4-ethyl-2,2-dimethylpentanedioate.
| Compound Name | 1-O-(oxiran-2-ylmethyl) 5-O-(1,1,2,2,2-pentafluoroethyl) 4-ethyl-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 59097402 |
| Molecular Formula | C14H19F5O5 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-O-(oxiran-2-ylmethyl) 5-O-(1,1,2,2,2-pentafluoroethyl) 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCC(CC(C)(C)C(=O)OCC1CO1)C(=O)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F5O5/c1-4-8(10(20)24-14(18,19)13(15,16)17)5-12(2,3)11(21)23-7-9-6-22-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | TXECRILJDPLQOC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|