C28H39NO9 — CID 59097433
(4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) 2,5-dihydroxy-5-methyl-2-(2-methylperoxyethyl)hexanoate (PubChem CID 59097433) has the molecular formula C28H39NO9 and a molecular weight of 533.62 g/mol. Its IUPAC name is (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) 2,5-dihydroxy-5-methyl-2-(2-methylperoxyethyl)hexanoate.
| Compound Name | (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) 2,5-dihydroxy-5-methyl-2-(2-methylperoxyethyl)hexanoate |
|---|---|
| PubChem CID | 59097433 |
| Molecular Formula | C28H39NO9 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | (4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl) 2,5-dihydroxy-5-methyl-2-(2-methylperoxyethyl)hexanoate |
| SMILES | COOCCC(O)(CCC(C)(C)O)C(=O)OC1C(OC)=CC23CCCN2CCc2cc4c(cc2C13)OCO4 |
| InChI | InChI=1S/C28H39NO9/c1-26(2,31)8-9-28(32,10-13-37-34-4)25(30)38-24-22(33-3)16-27-7-5-11-29(27)12-6-18-14-20-21(36-17-35-20)15-19(18)23(24)27/h14-16,23-24,31-32H,5-13,17H2,1-4H3 |
| InChIKey | LCYNEFBYMGKFAL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|