C16H21N3O3 — CID 59097444
5-(2,6-dimethyl-1-propan-2-yl-4-pyridinylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 59097444) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 5-(2,6-dimethyl-1-propan-2-yl-4-pyridinylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,6-dimethyl-1-propan-2-yl-4-pyridinylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 59097444 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 5-(2,6-dimethyl-1-propan-2-yl-4-pyridinylidene)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=CC(=C2C(=O)N(C)C(=O)N(C)C2=O)C=C(C)N1C(C)C |
| InChI | InChI=1S/C16H21N3O3/c1-9(2)19-10(3)7-12(8-11(19)4)13-14(20)17(5)16(22)18(6)15(13)21/h7-9H,1-6H3 |
| InChIKey | QTCWNZOSVOQXDW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|