C20H25N3O5S — CID 59097561
9-butoxy-3-[(2R,5R)-5-[[deuterio(tritio)methoxy]methyl]-4-tritiooxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazine-2-thione (PubChem CID 59097561) has the molecular formula C20H25N3O5S and a molecular weight of 424.53 g/mol. Its IUPAC name is 9-butoxy-3-[(2R,5R)-5-[[deuterio(tritio)methoxy]methyl]-4-tritiooxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazine-2-thione.
| Compound Name | 9-butoxy-3-[(2R,5R)-5-[[deuterio(tritio)methoxy]methyl]-4-tritiooxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazine-2-thione |
|---|---|
| PubChem CID | 59097561 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 9-butoxy-3-[(2R,5R)-5-[[deuterio(tritio)methoxy]methyl]-4-tritiooxyoxolan-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazine-2-thione |
| SMILES | [2H]C([3H])OC[C@H]1O[C@@H](n2cc3c(nc2=S)Nc2c(OCCCC)cccc2O3)CC1O[3H] |
| InChI | InChI=1S/C20H25N3O5S/c1-3-4-8-26-13-6-5-7-14-18(13)21-19-15(27-14)10-23(20(29)22-19)17-9-12(24)16(28-17)11-25-2/h5-7,10,12,16-17,24H,3-4,8-9,11H2,1-2H3,(H,21,22,29)/t12?,16-,17-/m1/s1/i2TD,24T/t2?,12?,16-,17- |
| InChIKey | KVPNYHMFSLOKTK-NGYICDNMSA-N |
| XLogP | 3.94 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|