About [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol
[3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol (PubChem CID 59097618) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol |
| PubChem CID | 59097618 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol |
| SMILES | CCCCNC1C(CO)OC(C)C1C |
| InChI | InChI=1S/C11H23NO2/c1-4-5-6-12-11-8(2)9(3)14-10(11)7-13/h8-13H,4-7H2,1-3H3 |
| InChIKey | RXRLUXSBHOIPMK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol?
The IUPAC name of [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol (CID 59097618) is [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol.
What is the SMILES notation for [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol?
The canonical SMILES for [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol is CCCCNC1C(CO)OC(C)C1C.
What is the InChIKey of [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol?
The InChIKey is RXRLUXSBHOIPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-4-5-6-12-11-8(2)9(3)14-10(11)7-13/h8-13H,4-7H2,1-3H3.
What are the key properties of [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol?
[3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol has a molecular weight of 201.31 g/mol, XLogP of 1.16, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(butylamino)-4,5-dimethyloxolan-2-yl]methanol is sourced from PubChem (CID 59097618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).