C8H11F3INO2 — CID 59097702
(Z,2S)-6,6,6-trifluoro-2-hydroxy-5-iodo-N,N-dimethylhex-4-enamide (PubChem CID 59097702) has the molecular formula C8H11F3INO2 and a molecular weight of 337.08 g/mol. Its IUPAC name is (Z,2S)-6,6,6-trifluoro-2-hydroxy-5-iodo-N,N-dimethylhex-4-enamide.
| Compound Name | (Z,2S)-6,6,6-trifluoro-2-hydroxy-5-iodo-N,N-dimethylhex-4-enamide |
|---|---|
| PubChem CID | 59097702 |
| Molecular Formula | C8H11F3INO2 |
| Molecular Weight | 337.08 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | (Z,2S)-6,6,6-trifluoro-2-hydroxy-5-iodo-N,N-dimethylhex-4-enamide |
| SMILES | CN(C)C(=O)[C@@H](O)C/C=C(\I)C(F)(F)F |
| InChI | InChI=1S/C8H11F3INO2/c1-13(2)7(15)5(14)3-4-6(12)8(9,10)11/h4-5,14H,3H2,1-2H3/b6-4-/t5-/m0/s1 |
| InChIKey | INVZDLACVSKVRK-YIWIKUPCSA-N |
| XLogP | 1.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|