About (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide
(Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide (PubChem CID 59097705) has the molecular formula C9H16INO2
and a molecular weight of 297.14 g/mol. Its IUPAC name is (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide.
Molecular Properties
| Compound Name | (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide |
| PubChem CID | 59097705 |
| Molecular Formula | C9H16INO2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide |
| SMILES | CC/C(I)=C/C[C@H](O)C(=O)N(C)C |
| InChI | InChI=1S/C9H16INO2/c1-4-7(10)5-6-8(12)9(13)11(2)3/h5,8,12H,4,6H2,1-3H3/b7-5-/t8-/m0/s1 |
| InChIKey | KXOJGHGGUHKVPV-TVSKSKRASA-N |
| XLogP | 1.55 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide?
The IUPAC name of (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide (CID 59097705) is (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide.
What is the SMILES notation for (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide?
The canonical SMILES for (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide is CC/C(I)=C/C[C@H](O)C(=O)N(C)C.
What is the InChIKey of (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide?
The InChIKey is KXOJGHGGUHKVPV-TVSKSKRASA-N. The full InChI is InChI=1S/C9H16INO2/c1-4-7(10)5-6-8(12)9(13)11(2)3/h5,8,12H,4,6H2,1-3H3/b7-5-/t8-/m0/s1.
What are the key properties of (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide?
(Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide has a molecular weight of 297.14 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2S)-2-hydroxy-5-iodo-N,N-dimethylhept-4-enamide is sourced from PubChem (CID 59097705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).