About aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol
aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol (PubChem CID 59097803) has the molecular formula C6H15N2O4Pt-
and a molecular weight of 374.27 g/mol. Its IUPAC name is aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol.
Molecular Properties
| Compound Name | aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol |
| PubChem CID | 59097803 |
| Molecular Formula | C6H15N2O4Pt- |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol |
| SMILES | NC=[Pt].OC(O)C1(C(O)O)CC1.[NH2-] |
| InChI | InChI=1S/C5H10O4.CH3N.H2N.Pt/c6-3(7)5(1-2-5)4(8)9;1-2;;/h3-4,6-9H,1-2H2;1H,2H2;1H2;/q;;-1; |
| InChIKey | GIBJYJSNLNDIDQ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol?
The IUPAC name of aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol (CID 59097803) is aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol.
What is the SMILES notation for aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol?
The canonical SMILES for aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol is NC=[Pt].OC(O)C1(C(O)O)CC1.[NH2-].
What is the InChIKey of aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol?
The InChIKey is GIBJYJSNLNDIDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O4.CH3N.H2N.Pt/c6-3(7)5(1-2-5)4(8)9;1-2;;/h3-4,6-9H,1-2H2;1H,2H2;1H2;/q;;-1;.
What are the key properties of aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol?
aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol has a molecular weight of 374.27 g/mol, XLogP of -1.64, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aminomethylideneplatinum;azanide;[1-(dihydroxymethyl)cyclopropyl]methanediol is sourced from PubChem (CID 59097803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).