C10H13N2Y- — CID 59097993
2-methyl-4,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-ide;yttrium (PubChem CID 59097993) has the molecular formula C10H13N2Y- and a molecular weight of 250.13 g/mol. Its IUPAC name is 2-methyl-4,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-ide;yttrium.
| Compound Name | 2-methyl-4,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-ide;yttrium |
|---|---|
| PubChem CID | 59097993 |
| Molecular Formula | C10H13N2Y- |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-methyl-4,5,6,7,8,9-hexahydrocyclohepta[d]pyrimidin-4-ide;yttrium |
| SMILES | Cc1n[c-]c2c(n1)CCCCC2.[Y] |
| InChI | InChI=1S/C10H13N2.Y/c1-8-11-7-9-5-3-2-4-6-10(9)12-8;/h2-6H2,1H3;/q-1; |
| InChIKey | CVSQUUDZFWCOGN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|