About 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine
2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine (PubChem CID 59097994) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine.
Molecular Properties
| Compound Name | 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
| PubChem CID | 59097994 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine |
| SMILES | Cc1ncc2c(n1)CCCCC2 |
| InChI | InChI=1S/C10H14N2/c1-8-11-7-9-5-3-2-4-6-10(9)12-8/h7H,2-6H2,1H3 |
| InChIKey | USLIBRLXLKCPIZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine?
The IUPAC name of 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine (CID 59097994) is 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine.
What is the SMILES notation for 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine?
The canonical SMILES for 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine is Cc1ncc2c(n1)CCCCC2.
What is the InChIKey of 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine?
The InChIKey is USLIBRLXLKCPIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-8-11-7-9-5-3-2-4-6-10(9)12-8/h7H,2-6H2,1H3.
What are the key properties of 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine?
2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine has a molecular weight of 162.24 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[d]pyrimidine is sourced from PubChem (CID 59097994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).