About 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium)
3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) (PubChem CID 59098098) has the molecular formula C7H7NY2-2
and a molecular weight of 282.95 g/mol. Its IUPAC name is 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium).
Molecular Properties
| Compound Name | 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) |
| PubChem CID | 59098098 |
| Molecular Formula | C7H7NY2-2 |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 282.87 |
| IUPAC Name | 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) |
| SMILES | Cc1[c-]nc(C)[c-]c1.[Y].[Y] |
| InChI | InChI=1S/C7H7N.2Y/c1-6-3-4-7(2)8-5-6;;/h3H,1-2H3;;/q-2;; |
| InChIKey | MHAIZSRQYWWPGD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium)?
The IUPAC name of 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) (CID 59098098) is 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium).
What is the SMILES notation for 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium)?
The canonical SMILES for 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) is Cc1[c-]nc(C)[c-]c1.[Y].[Y].
What is the InChIKey of 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium)?
The InChIKey is MHAIZSRQYWWPGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N.2Y/c1-6-3-4-7(2)8-5-6;;/h3H,1-2H3;;/q-2;;.
What are the key properties of 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium)?
3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) has a molecular weight of 282.95 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-2,5-dihydropyridine-2,5-diide;bis(yttrium) is sourced from PubChem (CID 59098098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).