C23H17F3N2O3 — CID 59099348
1-benzyl-3-isocyano-6-[3-(2-oxopropoxy)phenyl]-4-(trifluoromethyl)pyridin-2-one (PubChem CID 59099348) has the molecular formula C23H17F3N2O3 and a molecular weight of 426.39 g/mol. Its IUPAC name is 1-benzyl-3-isocyano-6-[3-(2-oxopropoxy)phenyl]-4-(trifluoromethyl)pyridin-2-one.
| Compound Name | 1-benzyl-3-isocyano-6-[3-(2-oxopropoxy)phenyl]-4-(trifluoromethyl)pyridin-2-one |
|---|---|
| PubChem CID | 59099348 |
| Molecular Formula | C23H17F3N2O3 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-benzyl-3-isocyano-6-[3-(2-oxopropoxy)phenyl]-4-(trifluoromethyl)pyridin-2-one |
| SMILES | [C-]#[N+]c1c(C(F)(F)F)cc(-c2cccc(OCC(C)=O)c2)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H17F3N2O3/c1-15(29)14-31-18-10-6-9-17(11-18)20-12-19(23(24,25)26)21(27-2)22(30)28(20)13-16-7-4-3-5-8-16/h3-12H,13-14H2,1H3 |
| InChIKey | DHXOBUZHVHEHNU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|