C6H10N2O — CID 59099593
5-methyl-4-(2-tritiooxyethyl)-1H-imidazole (PubChem CID 59099593) has the molecular formula C6H10N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 5-methyl-4-(2-tritiooxyethyl)-1H-imidazole.
| Compound Name | 5-methyl-4-(2-tritiooxyethyl)-1H-imidazole |
|---|---|
| PubChem CID | 59099593 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 5-methyl-4-(2-tritiooxyethyl)-1H-imidazole |
| SMILES | [3H]OCCc1nc[nH]c1C |
| InChI | InChI=1S/C6H10N2O/c1-5-6(2-3-9)8-4-7-5/h4,9H,2-3H2,1H3,(H,7,8)/i9T |
| InChIKey | ASCUVHKNQDPJNA-FIRFLZKJSA-N |
| XLogP | 0.25 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |