About 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde
4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde (PubChem CID 59099684) has the molecular formula C24H22O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde.
Molecular Properties
| Compound Name | 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde |
| PubChem CID | 59099684 |
| Molecular Formula | C24H22O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde |
| SMILES | C/C(=C/c1cc(C)cc(C)c1)c1ccc(Oc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C24H22O2/c1-17-12-18(2)14-21(13-17)15-19(3)22-6-10-24(11-7-22)26-23-8-4-20(16-25)5-9-23/h4-16H,1-3H3/b19-15- |
| InChIKey | JRWYOUPXJWJANT-CYVLTUHYSA-N |
| XLogP | 6.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde?
The IUPAC name of 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde (CID 59099684) is 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde.
What is the SMILES notation for 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde?
The canonical SMILES for 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde is C/C(=C/c1cc(C)cc(C)c1)c1ccc(Oc2ccc(C=O)cc2)cc1.
What is the InChIKey of 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde?
The InChIKey is JRWYOUPXJWJANT-CYVLTUHYSA-N. The full InChI is InChI=1S/C24H22O2/c1-17-12-18(2)14-21(13-17)15-19(3)22-6-10-24(11-7-22)26-23-8-4-20(16-25)5-9-23/h4-16H,1-3H3/b19-15-.
What are the key properties of 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde?
4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde has a molecular weight of 342.44 g/mol, XLogP of 6.47, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(Z)-1-(3,5-dimethylphenyl)prop-1-en-2-yl]phenoxy]benzaldehyde is sourced from PubChem (CID 59099684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).