C22H23N2OS+ — CID 59099830
3-ethyl-2-[(3-methyl-1,3-thiazolidin-2-ylidene)methyl]-4,5-diphenyl-1,3-oxazol-3-ium (PubChem CID 59099830) has the molecular formula C22H23N2OS+ and a molecular weight of 363.51 g/mol. Its IUPAC name is 3-ethyl-2-[(3-methyl-1,3-thiazolidin-2-ylidene)methyl]-4,5-diphenyl-1,3-oxazol-3-ium.
| Compound Name | 3-ethyl-2-[(3-methyl-1,3-thiazolidin-2-ylidene)methyl]-4,5-diphenyl-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 59099830 |
| Molecular Formula | C22H23N2OS+ |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 3-ethyl-2-[(3-methyl-1,3-thiazolidin-2-ylidene)methyl]-4,5-diphenyl-1,3-oxazol-3-ium |
| SMILES | CC[n+]1c(C=C2SCCN2C)oc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H23N2OS/c1-3-24-19(16-20-23(2)14-15-26-20)25-22(18-12-8-5-9-13-18)21(24)17-10-6-4-7-11-17/h4-13,16H,3,14-15H2,1-2H3/q+1 |
| InChIKey | GPJPKFJEWFKVOA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|