About (2S,3S)-2,3-dibenzylbutanedioic acid
(2S,3S)-2,3-dibenzylbutanedioic acid (PubChem CID 59100334) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is (2S,3S)-2,3-dibenzylbutanedioic acid.
Molecular Properties
| Compound Name | (2S,3S)-2,3-dibenzylbutanedioic acid |
| PubChem CID | 59100334 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (2S,3S)-2,3-dibenzylbutanedioic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H18O4/c19-17(20)15(11-13-7-3-1-4-8-13)16(18(21)22)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20)(H,21,22)/t15-,16-/m0/s1 |
| InChIKey | UUTKSMWBUAJELT-HOTGVXAUSA-N |
| XLogP | 2.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,3S)-2,3-dibenzylbutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2,3-dibenzylbutanedioic acid?
The IUPAC name of (2S,3S)-2,3-dibenzylbutanedioic acid (CID 59100334) is (2S,3S)-2,3-dibenzylbutanedioic acid.
What is the SMILES notation for (2S,3S)-2,3-dibenzylbutanedioic acid?
The canonical SMILES for (2S,3S)-2,3-dibenzylbutanedioic acid is O=C(O)[C@@H](Cc1ccccc1)[C@H](Cc1ccccc1)C(=O)O.
What is the InChIKey of (2S,3S)-2,3-dibenzylbutanedioic acid?
The InChIKey is UUTKSMWBUAJELT-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H18O4/c19-17(20)15(11-13-7-3-1-4-8-13)16(18(21)22)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,20)(H,21,22)/t15-,16-/m0/s1.
What are the key properties of (2S,3S)-2,3-dibenzylbutanedioic acid?
(2S,3S)-2,3-dibenzylbutanedioic acid has a molecular weight of 298.34 g/mol, XLogP of 2.87, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2,3-dibenzylbutanedioic acid is sourced from PubChem (CID 59100334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).