About 5-(bromomethyl)-2,1,3-benzothiadiazole
5-(bromomethyl)-2,1,3-benzothiadiazole (PubChem CID 591004) has the molecular formula C7H5BrN2S
and a molecular weight of 229.10 g/mol. Its IUPAC name is 5-(bromomethyl)-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-(bromomethyl)-2,1,3-benzothiadiazole |
| PubChem CID | 591004 |
| Molecular Formula | C7H5BrN2S |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 227.94 |
| IUPAC Name | 5-(bromomethyl)-2,1,3-benzothiadiazole |
| SMILES | BrCc1ccc2nsnc2c1 |
| InChI | InChI=1S/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2 |
| InChIKey | JEPACAAYCVWCFI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(bromomethyl)-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(bromomethyl)-2,1,3-benzothiadiazole?
The IUPAC name of 5-(bromomethyl)-2,1,3-benzothiadiazole (CID 591004) is 5-(bromomethyl)-2,1,3-benzothiadiazole.
What is the SMILES notation for 5-(bromomethyl)-2,1,3-benzothiadiazole?
The canonical SMILES for 5-(bromomethyl)-2,1,3-benzothiadiazole is BrCc1ccc2nsnc2c1.
What is the InChIKey of 5-(bromomethyl)-2,1,3-benzothiadiazole?
The InChIKey is JEPACAAYCVWCFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2S/c8-4-5-1-2-6-7(3-5)10-11-9-6/h1-3H,4H2.
What are the key properties of 5-(bromomethyl)-2,1,3-benzothiadiazole?
5-(bromomethyl)-2,1,3-benzothiadiazole has a molecular weight of 229.10 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(bromomethyl)-2,1,3-benzothiadiazole is sourced from PubChem (CID 591004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).