C20H38O — CID 59101265
(3R,6S)-2-ethyl-3,4,5-trimethyl-6-[(Z,3S,4R,5R)-3,4,5-trimethylhept-1-enyl]oxane (PubChem CID 59101265) has the molecular formula C20H38O and a molecular weight of 294.52 g/mol. Its IUPAC name is (3R,6S)-2-ethyl-3,4,5-trimethyl-6-[(Z,3S,4R,5R)-3,4,5-trimethylhept-1-enyl]oxane.
| Compound Name | (3R,6S)-2-ethyl-3,4,5-trimethyl-6-[(Z,3S,4R,5R)-3,4,5-trimethylhept-1-enyl]oxane |
|---|---|
| PubChem CID | 59101265 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | (3R,6S)-2-ethyl-3,4,5-trimethyl-6-[(Z,3S,4R,5R)-3,4,5-trimethylhept-1-enyl]oxane |
| SMILES | CCC1O[C@@H](/C=C\[C@H](C)[C@H](C)[C@H](C)CC)C(C)C(C)[C@H]1C |
| InChI | InChI=1S/C20H38O/c1-9-13(3)15(5)14(4)11-12-20-18(8)16(6)17(7)19(10-2)21-20/h11-20H,9-10H2,1-8H3/b12-11-/t13-,14+,15-,16?,17-,18?,19?,20+/m1/s1 |
| InChIKey | WSRCOZRAHJQZFK-OJTSVPIOSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|