C11H19NO — CID 59101300
(2S,5R)-6-ethyl-3,4,5-trimethyloxane-2-carbonitrile (PubChem CID 59101300) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S,5R)-6-ethyl-3,4,5-trimethyloxane-2-carbonitrile.
| Compound Name | (2S,5R)-6-ethyl-3,4,5-trimethyloxane-2-carbonitrile |
|---|---|
| PubChem CID | 59101300 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2S,5R)-6-ethyl-3,4,5-trimethyloxane-2-carbonitrile |
| SMILES | CCC1O[C@H](C#N)C(C)C(C)[C@H]1C |
| InChI | InChI=1S/C11H19NO/c1-5-10-8(3)7(2)9(4)11(6-12)13-10/h7-11H,5H2,1-4H3/t7?,8-,9?,10?,11-/m1/s1 |
| InChIKey | KOXWARQZJHETAW-PBPDKXIHSA-N |
| XLogP | 2.60 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |