About N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide
N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide (PubChem CID 591014) has the molecular formula C11H17N5O
and a molecular weight of 235.29 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide |
| PubChem CID | 591014 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide |
| SMILES | Cc1cc(C)nc(N=C(N)N2CCOCC2)n1 |
| InChI | InChI=1S/C11H17N5O/c1-8-7-9(2)14-11(13-8)15-10(12)16-3-5-17-6-4-16/h7H,3-6H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | DKCVBDHHCJHLCS-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide?
The IUPAC name of N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide (CID 591014) is N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide.
What is the SMILES notation for N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide?
The canonical SMILES for N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide is Cc1cc(C)nc(N=C(N)N2CCOCC2)n1.
What is the InChIKey of N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide?
The InChIKey is DKCVBDHHCJHLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O/c1-8-7-9(2)14-11(13-8)15-10(12)16-3-5-17-6-4-16/h7H,3-6H2,1-2H3,(H2,12,13,14,15).
What are the key properties of N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide?
N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide has a molecular weight of 235.29 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4,6-dimethylpyrimidin-2-yl)morpholine-4-carboximidamide is sourced from PubChem (CID 591014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).