C20H19N5OS — CID 59101466
(1S,4S)-N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanylmethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 59101466) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is (1S,4S)-N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanylmethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1S,4S)-N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanylmethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 59101466 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (1S,4S)-N-[3-(1H-pyrazolo[5,4-d]pyrimidin-4-ylsulfanylmethyl)phenyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | O=C(Nc1cccc(CSc2ncnc3[nH]ncc23)c1)C1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C20H19N5OS/c26-19(16-8-12-4-5-14(16)6-12)24-15-3-1-2-13(7-15)10-27-20-17-9-23-25-18(17)21-11-22-20/h1-5,7,9,11-12,14,16H,6,8,10H2,(H,24,26)(H,21,22,23,25)/t12-,14+,16?/m0/s1 |
| InChIKey | ZCSOTFCWLHCGPX-XNVGXSDDSA-N |
| XLogP | 3.80 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|