About (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane
(5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 59101627) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane |
| PubChem CID | 59101627 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)CC2CN[C@@H](C2)C1 |
| InChI | InChI=1S/C9H17N/c1-9(2)4-7-3-8(5-9)10-6-7/h7-8,10H,3-6H2,1-2H3/t7?,8-/m0/s1 |
| InChIKey | LECZNJOGZQCLCE-MQWKRIRWSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane?
The IUPAC name of (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane (CID 59101627) is (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane.
What is the SMILES notation for (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane?
The canonical SMILES for (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane is CC1(C)CC2CN[C@@H](C2)C1.
What is the InChIKey of (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane?
The InChIKey is LECZNJOGZQCLCE-MQWKRIRWSA-N. The full InChI is InChI=1S/C9H17N/c1-9(2)4-7-3-8(5-9)10-6-7/h7-8,10H,3-6H2,1-2H3/t7?,8-/m0/s1.
What are the key properties of (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane?
(5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane has a molecular weight of 139.24 g/mol, XLogP of 1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,3-dimethyl-6-azabicyclo[3.2.1]octane is sourced from PubChem (CID 59101627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).