About 2,2,2-trifluoro-N-phenylacetamide;yttrium
2,2,2-trifluoro-N-phenylacetamide;yttrium (PubChem CID 59101643) has the molecular formula C8H5F3NOY-
and a molecular weight of 277.03 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-phenylacetamide;yttrium.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-phenylacetamide;yttrium |
| PubChem CID | 59101643 |
| Molecular Formula | C8H5F3NOY- |
| Molecular Weight | 277.03 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 2,2,2-trifluoro-N-phenylacetamide;yttrium |
| SMILES | O=C(Nc1[c-]cccc1)C(F)(F)F.[Y] |
| InChI | InChI=1S/C8H5F3NO.Y/c9-8(10,11)7(13)12-6-4-2-1-3-5-6;/h1-4H,(H,12,13);/q-1; |
| InChIKey | VGTIZVQJVKZQNU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.03 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trifluoro-N-phenylacetamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-phenylacetamide;yttrium?
The IUPAC name of 2,2,2-trifluoro-N-phenylacetamide;yttrium (CID 59101643) is 2,2,2-trifluoro-N-phenylacetamide;yttrium.
What is the SMILES notation for 2,2,2-trifluoro-N-phenylacetamide;yttrium?
The canonical SMILES for 2,2,2-trifluoro-N-phenylacetamide;yttrium is O=C(Nc1[c-]cccc1)C(F)(F)F.[Y].
What is the InChIKey of 2,2,2-trifluoro-N-phenylacetamide;yttrium?
The InChIKey is VGTIZVQJVKZQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3NO.Y/c9-8(10,11)7(13)12-6-4-2-1-3-5-6;/h1-4H,(H,12,13);/q-1;.
What are the key properties of 2,2,2-trifluoro-N-phenylacetamide;yttrium?
2,2,2-trifluoro-N-phenylacetamide;yttrium has a molecular weight of 277.03 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-phenylacetamide;yttrium is sourced from PubChem (CID 59101643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).