About CID 59101661
CID 59101661 (PubChem CID 59101661) has the molecular formula C8H10NO2
and a molecular weight of 152.17 g/mol.
Molecular Properties
| Compound Name | CID 59101661 |
| PubChem CID | 59101661 |
| Molecular Formula | C8H10NO2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | — |
| SMILES | O=C1NC2CC3[CH]C(O1)C2C3 |
| InChI | InChI=1S/C8H10NO2/c10-8-9-6-2-4-1-5(6)7(3-4)11-8/h3-7H,1-2H2,(H,9,10) |
| InChIKey | GDUYAVIGVFIEQG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59101661 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59101661?
The IUPAC name of CID 59101661 (CID 59101661) is not available.
What is the SMILES notation for CID 59101661?
The canonical SMILES for CID 59101661 is O=C1NC2CC3[CH]C(O1)C2C3.
What is the InChIKey of CID 59101661?
The InChIKey is GDUYAVIGVFIEQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10NO2/c10-8-9-6-2-4-1-5(6)7(3-4)11-8/h3-7H,1-2H2,(H,9,10).
What are the key properties of CID 59101661?
CID 59101661 has a molecular weight of 152.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59101661 is sourced from PubChem (CID 59101661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).